C18H33N3O2 — CID 125417865
(7R,8aS)-2-(2-methylpropyl)-1'-(oxan-4-yl)spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-7-ol (PubChem CID 125417865) has the molecular formula C18H33N3O2 and a molecular weight of 323.48 g/mol. Its IUPAC name is (7R,8aS)-2-(2-methylpropyl)-1'-(oxan-4-yl)spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-7-ol.
| Compound Name | (7R,8aS)-2-(2-methylpropyl)-1'-(oxan-4-yl)spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-7-ol |
|---|---|
| PubChem CID | 125417865 |
| Molecular Formula | C18H33N3O2 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.26 |
| IUPAC Name | (7R,8aS)-2-(2-methylpropyl)-1'-(oxan-4-yl)spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-7-ol |
| SMILES | CC(C)CN1C[C@@H]2C[C@@H](O)CN2C2(C1)CN(C1CCOCC1)C2 |
| InChI | InChI=1S/C18H33N3O2/c1-14(2)8-19-9-16-7-17(22)10-21(16)18(11-19)12-20(13-18)15-3-5-23-6-4-15/h14-17,22H,3-13H2,1-2H3/t16-,17+/m0/s1 |
| InChIKey | NGMSNDAYWVZSDB-DLBZAZTESA-N |
| XLogP | 0.63 |
| TPSA | 39.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |