C21H33N3O2 — CID 162800128
1'-[(4-methoxyphenyl)methyl]-2-(2-methylpropyl)spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-7-ol (PubChem CID 162800128) has the molecular formula C21H33N3O2 and a molecular weight of 359.51 g/mol. Its IUPAC name is 1'-[(4-methoxyphenyl)methyl]-2-(2-methylpropyl)spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-7-ol.
| Compound Name | 1'-[(4-methoxyphenyl)methyl]-2-(2-methylpropyl)spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-7-ol |
|---|---|
| PubChem CID | 162800128 |
| Molecular Formula | C21H33N3O2 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.26 |
| IUPAC Name | 1'-[(4-methoxyphenyl)methyl]-2-(2-methylpropyl)spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-7-ol |
| SMILES | COc1ccc(CN2CC3(CN(CC(C)C)CC4CC(O)CN43)C2)cc1 |
| InChI | InChI=1S/C21H33N3O2/c1-16(2)9-22-11-18-8-19(25)12-24(18)21(13-22)14-23(15-21)10-17-4-6-20(26-3)7-5-17/h4-7,16,18-19,25H,8-15H2,1-3H3 |
| InChIKey | AYGXOEVPWVETGM-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 39.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |