C17H22N2O4S — CID 125419378
(3R)-1-(benzenesulfonyl)-N-[(2R)-1-methoxybut-3-yn-2-yl]piperidine-3-carboxamide (PubChem CID 125419378) has the molecular formula C17H22N2O4S and a molecular weight of 350.44 g/mol. Its IUPAC name is (3R)-1-(benzenesulfonyl)-N-[(2R)-1-methoxybut-3-yn-2-yl]piperidine-3-carboxamide.
| Compound Name | (3R)-1-(benzenesulfonyl)-N-[(2R)-1-methoxybut-3-yn-2-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 125419378 |
| Molecular Formula | C17H22N2O4S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | (3R)-1-(benzenesulfonyl)-N-[(2R)-1-methoxybut-3-yn-2-yl]piperidine-3-carboxamide |
| SMILES | C#C[C@H](COC)NC(=O)[C@@H]1CCCN(S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C17H22N2O4S/c1-3-15(13-23-2)18-17(20)14-8-7-11-19(12-14)24(21,22)16-9-5-4-6-10-16/h1,4-6,9-10,14-15H,7-8,11-13H2,2H3,(H,18,20)/t14-,15-/m1/s1 |
| InChIKey | VIPWKEQQVMNDBI-HUUCEWRRSA-N |
| XLogP | 0.85 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|