C13H14BrNO3 — CID 125419756
2-bromo-N-[(2R)-1-hydroxypent-4-yn-2-yl]-5-methoxybenzamide (PubChem CID 125419756) has the molecular formula C13H14BrNO3 and a molecular weight of 312.16 g/mol. Its IUPAC name is 2-bromo-N-[(2R)-1-hydroxypent-4-yn-2-yl]-5-methoxybenzamide.
| Compound Name | 2-bromo-N-[(2R)-1-hydroxypent-4-yn-2-yl]-5-methoxybenzamide |
|---|---|
| PubChem CID | 125419756 |
| Molecular Formula | C13H14BrNO3 |
| Molecular Weight | 312.16 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | 2-bromo-N-[(2R)-1-hydroxypent-4-yn-2-yl]-5-methoxybenzamide |
| SMILES | C#CC[C@H](CO)NC(=O)c1cc(OC)ccc1Br |
| InChI | InChI=1S/C13H14BrNO3/c1-3-4-9(8-16)15-13(17)11-7-10(18-2)5-6-12(11)14/h1,5-7,9,16H,4,8H2,2H3,(H,15,17)/t9-/m1/s1 |
| InChIKey | YXPORJSOSWQHDA-SECBINFHSA-N |
| XLogP | 1.57 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.16 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|