C15H20FN3O4 — CID 125421874
tert-butyl N-[[1-(6-fluoropyridine-3-carbonyl)-3-hydroxyazetidin-3-yl]methyl]carbamate (PubChem CID 125421874) has the molecular formula C15H20FN3O4 and a molecular weight of 325.34 g/mol. Its IUPAC name is tert-butyl N-[[1-(6-fluoropyridine-3-carbonyl)-3-hydroxyazetidin-3-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-(6-fluoropyridine-3-carbonyl)-3-hydroxyazetidin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 125421874 |
| Molecular Formula | C15H20FN3O4 |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | tert-butyl N-[[1-(6-fluoropyridine-3-carbonyl)-3-hydroxyazetidin-3-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1(O)CN(C(=O)c2ccc(F)nc2)C1 |
| InChI | InChI=1S/C15H20FN3O4/c1-14(2,3)23-13(21)18-7-15(22)8-19(9-15)12(20)10-4-5-11(16)17-6-10/h4-6,22H,7-9H2,1-3H3,(H,18,21) |
| InChIKey | VNLPZZAVMRBFBD-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|