C19H28FN3O5 — CID 139307818
methyl 2-[[(6-fluoropyridine-3-carbonyl)amino]methyl]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate (PubChem CID 139307818) has the molecular formula C19H28FN3O5 and a molecular weight of 397.45 g/mol. Its IUPAC name is methyl 2-[[(6-fluoropyridine-3-carbonyl)amino]methyl]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate.
| Compound Name | methyl 2-[[(6-fluoropyridine-3-carbonyl)amino]methyl]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 139307818 |
| Molecular Formula | C19H28FN3O5 |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | methyl 2-[[(6-fluoropyridine-3-carbonyl)amino]methyl]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
| SMILES | COC(=O)C(CCCCNC(=O)OC(C)(C)C)CNC(=O)c1ccc(F)nc1 |
| InChI | InChI=1S/C19H28FN3O5/c1-19(2,3)28-18(26)21-10-6-5-7-14(17(25)27-4)12-23-16(24)13-8-9-15(20)22-11-13/h8-9,11,14H,5-7,10,12H2,1-4H3,(H,21,26)(H,23,24) |
| InChIKey | JRXBJWJIVFPJFX-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|