C14H18N4S — CID 125423818
3-ethyl-5-[(3S)-3-pyridin-2-ylpiperidin-1-yl]-1,2,4-thiadiazole (PubChem CID 125423818) has the molecular formula C14H18N4S and a molecular weight of 274.39 g/mol. Its IUPAC name is 3-ethyl-5-[(3S)-3-pyridin-2-ylpiperidin-1-yl]-1,2,4-thiadiazole.
| Compound Name | 3-ethyl-5-[(3S)-3-pyridin-2-ylpiperidin-1-yl]-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 125423818 |
| Molecular Formula | C14H18N4S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 3-ethyl-5-[(3S)-3-pyridin-2-ylpiperidin-1-yl]-1,2,4-thiadiazole |
| SMILES | CCc1nsc(N2CCC[C@H](c3ccccn3)C2)n1 |
| InChI | InChI=1S/C14H18N4S/c1-2-13-16-14(19-17-13)18-9-5-6-11(10-18)12-7-3-4-8-15-12/h3-4,7-8,11H,2,5-6,9-10H2,1H3/t11-/m0/s1 |
| InChIKey | GSNCGGNVQILWRQ-NSHDSACASA-N |
| XLogP | 2.88 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |