About 2-[(2R,3S)-1-[(5-chloro-1,3-thiazol-2-yl)methyl]-3-methylpiperidin-2-yl]ethanol
2-[(2R,3S)-1-[(5-chloro-1,3-thiazol-2-yl)methyl]-3-methylpiperidin-2-yl]ethanol (PubChem CID 125424127) has the molecular formula C12H19ClN2OS
and a molecular weight of 274.82 g/mol. Its IUPAC name is 2-[(2R,3S)-1-[(5-chloro-1,3-thiazol-2-yl)methyl]-3-methylpiperidin-2-yl]ethanol.
Molecular Properties
| Compound Name | 2-[(2R,3S)-1-[(5-chloro-1,3-thiazol-2-yl)methyl]-3-methylpiperidin-2-yl]ethanol |
| PubChem CID | 125424127 |
| Molecular Formula | C12H19ClN2OS |
| Molecular Weight | 274.82 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 2-[(2R,3S)-1-[(5-chloro-1,3-thiazol-2-yl)methyl]-3-methylpiperidin-2-yl]ethanol |
| SMILES | C[C@H]1CCCN(Cc2ncc(Cl)s2)[C@@H]1CCO |
| InChI | InChI=1S/C12H19ClN2OS/c1-9-3-2-5-15(10(9)4-6-16)8-12-14-7-11(13)17-12/h7,9-10,16H,2-6,8H2,1H3/t9-,10+/m0/s1 |
| InChIKey | QWYFLNCPSJZVJL-VHSXEESVSA-N |
| XLogP | 2.78 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.82 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(2R,3S)-1-[(5-chloro-1,3-thiazol-2-yl)methyl]-3-methylpiperidin-2-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2R,3S)-1-[(5-chloro-1,3-thiazol-2-yl)methyl]-3-methylpiperidin-2-yl]ethanol?
The IUPAC name of 2-[(2R,3S)-1-[(5-chloro-1,3-thiazol-2-yl)methyl]-3-methylpiperidin-2-yl]ethanol (CID 125424127) is 2-[(2R,3S)-1-[(5-chloro-1,3-thiazol-2-yl)methyl]-3-methylpiperidin-2-yl]ethanol.
What is the SMILES notation for 2-[(2R,3S)-1-[(5-chloro-1,3-thiazol-2-yl)methyl]-3-methylpiperidin-2-yl]ethanol?
The canonical SMILES for 2-[(2R,3S)-1-[(5-chloro-1,3-thiazol-2-yl)methyl]-3-methylpiperidin-2-yl]ethanol is C[C@H]1CCCN(Cc2ncc(Cl)s2)[C@@H]1CCO.
What is the InChIKey of 2-[(2R,3S)-1-[(5-chloro-1,3-thiazol-2-yl)methyl]-3-methylpiperidin-2-yl]ethanol?
The InChIKey is QWYFLNCPSJZVJL-VHSXEESVSA-N. The full InChI is InChI=1S/C12H19ClN2OS/c1-9-3-2-5-15(10(9)4-6-16)8-12-14-7-11(13)17-12/h7,9-10,16H,2-6,8H2,1H3/t9-,10+/m0/s1.
What are the key properties of 2-[(2R,3S)-1-[(5-chloro-1,3-thiazol-2-yl)methyl]-3-methylpiperidin-2-yl]ethanol?
2-[(2R,3S)-1-[(5-chloro-1,3-thiazol-2-yl)methyl]-3-methylpiperidin-2-yl]ethanol has a molecular weight of 274.82 g/mol, XLogP of 2.78, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2R,3S)-1-[(5-chloro-1,3-thiazol-2-yl)methyl]-3-methylpiperidin-2-yl]ethanol is sourced from PubChem (CID 125424127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).