C11H11F4N — CID 125425791
2-fluoro-4-(trifluoromethyl)-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridine (PubChem CID 125425791) has the molecular formula C11H11F4N and a molecular weight of 233.21 g/mol. Its IUPAC name is 2-fluoro-4-(trifluoromethyl)-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridine.
| Compound Name | 2-fluoro-4-(trifluoromethyl)-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridine |
|---|---|
| PubChem CID | 125425791 |
| Molecular Formula | C11H11F4N |
| Molecular Weight | 233.21 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 2-fluoro-4-(trifluoromethyl)-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridine |
| SMILES | Fc1cc(C(F)(F)F)c2c(n1)CCCCC2 |
| InChI | InChI=1S/C11H11F4N/c12-10-6-8(11(13,14)15)7-4-2-1-3-5-9(7)16-10/h6H,1-5H2 |
| InChIKey | NHCDSDIJBWXURK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.21 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|