C11H12Br2OS — CID 125426605
(2R,3S)-3-(3,5-dibromophenyl)-2-methylthiolan-3-ol (PubChem CID 125426605) has the molecular formula C11H12Br2OS and a molecular weight of 352.09 g/mol. Its IUPAC name is (2R,3S)-3-(3,5-dibromophenyl)-2-methylthiolan-3-ol.
| Compound Name | (2R,3S)-3-(3,5-dibromophenyl)-2-methylthiolan-3-ol |
|---|---|
| PubChem CID | 125426605 |
| Molecular Formula | C11H12Br2OS |
| Molecular Weight | 352.09 g/mol |
| Exact Mass | 349.90 |
| IUPAC Name | (2R,3S)-3-(3,5-dibromophenyl)-2-methylthiolan-3-ol |
| SMILES | C[C@H]1SCC[C@]1(O)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C11H12Br2OS/c1-7-11(14,2-3-15-7)8-4-9(12)6-10(13)5-8/h4-7,14H,2-3H2,1H3/t7-,11-/m1/s1 |
| InChIKey | HYDWTGZUKWWISR-RDDDGLTNSA-N |
| XLogP | 3.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.09 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |