C9H16F3NO2S — CID 125426659
(3R,5S)-5-amino-6-ethylsulfanyl-3-(trifluoromethyl)hexanoic acid (PubChem CID 125426659) has the molecular formula C9H16F3NO2S and a molecular weight of 259.29 g/mol. Its IUPAC name is (3R,5S)-5-amino-6-ethylsulfanyl-3-(trifluoromethyl)hexanoic acid.
| Compound Name | (3R,5S)-5-amino-6-ethylsulfanyl-3-(trifluoromethyl)hexanoic acid |
|---|---|
| PubChem CID | 125426659 |
| Molecular Formula | C9H16F3NO2S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | (3R,5S)-5-amino-6-ethylsulfanyl-3-(trifluoromethyl)hexanoic acid |
| SMILES | CCSC[C@@H](N)C[C@H](CC(=O)O)C(F)(F)F |
| InChI | InChI=1S/C9H16F3NO2S/c1-2-16-5-7(13)3-6(4-8(14)15)9(10,11)12/h6-7H,2-5,13H2,1H3,(H,14,15)/t6-,7+/m1/s1 |
| InChIKey | IQTYKPZDYRIZLN-RQJHMYQMSA-N |
| XLogP | 2.11 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |