C8H15F3N2O2 — CID 125425862
(3R,5R)-5-amino-6-(methylamino)-3-(trifluoromethyl)hexanoic acid (PubChem CID 125425862) has the molecular formula C8H15F3N2O2 and a molecular weight of 228.21 g/mol. Its IUPAC name is (3R,5R)-5-amino-6-(methylamino)-3-(trifluoromethyl)hexanoic acid.
| Compound Name | (3R,5R)-5-amino-6-(methylamino)-3-(trifluoromethyl)hexanoic acid |
|---|---|
| PubChem CID | 125425862 |
| Molecular Formula | C8H15F3N2O2 |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | (3R,5R)-5-amino-6-(methylamino)-3-(trifluoromethyl)hexanoic acid |
| SMILES | CNC[C@H](N)C[C@H](CC(=O)O)C(F)(F)F |
| InChI | InChI=1S/C8H15F3N2O2/c1-13-4-6(12)2-5(3-7(14)15)8(9,10)11/h5-6,13H,2-4,12H2,1H3,(H,14,15)/t5-,6-/m1/s1 |
| InChIKey | CKWAUZMBYAYPFG-PHDIDXHHSA-N |
| XLogP | 0.58 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |