C11H18F3NO4 — CID 50986501
5-(((Tert-butoxy)carbonyl)amino)-3-(trifluoromethyl)pentanoic acid (PubChem CID 50986501) has the molecular formula C11H18F3NO4 and a molecular weight of 285.26 g/mol. Its IUPAC name is 5-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(trifluoromethyl)pentanoic acid.
| Compound Name | 5-(((Tert-butoxy)carbonyl)amino)-3-(trifluoromethyl)pentanoic acid |
|---|---|
| PubChem CID | 50986501 |
| Molecular Formula | C11H18F3NO4 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 5-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(trifluoromethyl)pentanoic acid |
| SMILES | CC(C)(C)OC(=O)NCCC(CC(=O)O)C(F)(F)F |
| InChI | InChI=1S/C11H18F3NO4/c1-10(2,3)19-9(18)15-5-4-7(6-8(16)17)11(12,13)14/h7H,4-6H2,1-3H3,(H,15,18)(H,16,17) |
| InChIKey | VBVHGWGVTGSANP-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | 323 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |