C14H23F3N2O3 — CID 122152191
tert-butyl N-[4,4,4-trifluoro-3-(3-methylbut-2-enoylamino)butyl]carbamate (PubChem CID 122152191) has the molecular formula C14H23F3N2O3 and a molecular weight of 324.34 g/mol. Its IUPAC name is tert-butyl N-[4,4,4-trifluoro-3-(3-methylbut-2-enoylamino)butyl]carbamate.
| Compound Name | tert-butyl N-[4,4,4-trifluoro-3-(3-methylbut-2-enoylamino)butyl]carbamate |
|---|---|
| PubChem CID | 122152191 |
| Molecular Formula | C14H23F3N2O3 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | tert-butyl N-[4,4,4-trifluoro-3-(3-methylbut-2-enoylamino)butyl]carbamate |
| SMILES | CC(C)=CC(=O)NC(CCNC(=O)OC(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C14H23F3N2O3/c1-9(2)8-11(20)19-10(14(15,16)17)6-7-18-12(21)22-13(3,4)5/h8,10H,6-7H2,1-5H3,(H,18,21)(H,19,20) |
| InChIKey | HTCHPKNFNIEAEX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|