C14H28N2O4S2 — CID 87197221
tert-butyl N-[4-[(2-methylpropan-2-yl)oxycarbonylamino]-1,2-bis(sulfanyl)butyl]carbamate (PubChem CID 87197221) has the molecular formula C14H28N2O4S2 and a molecular weight of 352.52 g/mol. Its IUPAC name is tert-butyl N-[4-[(2-methylpropan-2-yl)oxycarbonylamino]-1,2-bis(sulfanyl)butyl]carbamate.
| Compound Name | tert-butyl N-[4-[(2-methylpropan-2-yl)oxycarbonylamino]-1,2-bis(sulfanyl)butyl]carbamate |
|---|---|
| PubChem CID | 87197221 |
| Molecular Formula | C14H28N2O4S2 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | tert-butyl N-[4-[(2-methylpropan-2-yl)oxycarbonylamino]-1,2-bis(sulfanyl)butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(S)C(S)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H28N2O4S2/c1-13(2,3)19-11(17)15-8-7-9(21)10(22)16-12(18)20-14(4,5)6/h9-10,21-22H,7-8H2,1-6H3,(H,15,17)(H,16,18) |
| InChIKey | RZUAQRKWSXPNPL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|