C17H24F3NO5 — CID 167806558
5-[[1-[(2-methylpropan-2-yl)oxycarbonyl]cyclopent-3-ene-1-carbonyl]amino]-3-(trifluoromethyl)pentanoic acid (PubChem CID 167806558) has the molecular formula C17H24F3NO5 and a molecular weight of 379.38 g/mol. Its IUPAC name is 5-[[1-[(2-methylpropan-2-yl)oxycarbonyl]cyclopent-3-ene-1-carbonyl]amino]-3-(trifluoromethyl)pentanoic acid.
| Compound Name | 5-[[1-[(2-methylpropan-2-yl)oxycarbonyl]cyclopent-3-ene-1-carbonyl]amino]-3-(trifluoromethyl)pentanoic acid |
|---|---|
| PubChem CID | 167806558 |
| Molecular Formula | C17H24F3NO5 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 5-[[1-[(2-methylpropan-2-yl)oxycarbonyl]cyclopent-3-ene-1-carbonyl]amino]-3-(trifluoromethyl)pentanoic acid |
| SMILES | CC(C)(C)OC(=O)C1(C(=O)NCCC(CC(=O)O)C(F)(F)F)CC=CC1 |
| InChI | InChI=1S/C17H24F3NO5/c1-15(2,3)26-14(25)16(7-4-5-8-16)13(24)21-9-6-11(10-12(22)23)17(18,19)20/h4-5,11H,6-10H2,1-3H3,(H,21,24)(H,22,23) |
| InChIKey | MGPNJJLFHUNGOI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|