About tert-butyl N-[5-[3-(1,3-dioxolan-2-yl)-2-pyridinyl]-5-oxo-3-(trifluoromethyl)pentyl]carbamate
tert-butyl N-[5-[3-(1,3-dioxolan-2-yl)-2-pyridinyl]-5-oxo-3-(trifluoromethyl)pentyl]carbamate (PubChem CID 170947928) has the molecular formula C19H25F3N2O5
and a molecular weight of 418.41 g/mol. Its IUPAC name is tert-butyl N-[5-[3-(1,3-dioxolan-2-yl)-2-pyridinyl]-5-oxo-3-(trifluoromethyl)pentyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[5-[3-(1,3-dioxolan-2-yl)-2-pyridinyl]-5-oxo-3-(trifluoromethyl)pentyl]carbamate |
| PubChem CID | 170947928 |
| Molecular Formula | C19H25F3N2O5 |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | tert-butyl N-[5-[3-(1,3-dioxolan-2-yl)-2-pyridinyl]-5-oxo-3-(trifluoromethyl)pentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(CC(=O)c1ncccc1C1OCCO1)C(F)(F)F |
| InChI | InChI=1S/C19H25F3N2O5/c1-18(2,3)29-17(26)24-8-6-12(19(20,21)22)11-14(25)15-13(5-4-7-23-15)16-27-9-10-28-16/h4-5,7,12,16H,6,8-11H2,1-3H3,(H,24,26) |
| InChIKey | LXQJFVAXRUDIER-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl N-[5-[3-(1,3-dioxolan-2-yl)-2-pyridinyl]-5-oxo-3-(trifluoromethyl)pentyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[5-[3-(1,3-dioxolan-2-yl)-2-pyridinyl]-5-oxo-3-(trifluoromethyl)pentyl]carbamate?
The IUPAC name of tert-butyl N-[5-[3-(1,3-dioxolan-2-yl)-2-pyridinyl]-5-oxo-3-(trifluoromethyl)pentyl]carbamate (CID 170947928) is tert-butyl N-[5-[3-(1,3-dioxolan-2-yl)-2-pyridinyl]-5-oxo-3-(trifluoromethyl)pentyl]carbamate.
What is the SMILES notation for tert-butyl N-[5-[3-(1,3-dioxolan-2-yl)-2-pyridinyl]-5-oxo-3-(trifluoromethyl)pentyl]carbamate?
The canonical SMILES for tert-butyl N-[5-[3-(1,3-dioxolan-2-yl)-2-pyridinyl]-5-oxo-3-(trifluoromethyl)pentyl]carbamate is CC(C)(C)OC(=O)NCCC(CC(=O)c1ncccc1C1OCCO1)C(F)(F)F.
What is the InChIKey of tert-butyl N-[5-[3-(1,3-dioxolan-2-yl)-2-pyridinyl]-5-oxo-3-(trifluoromethyl)pentyl]carbamate?
The InChIKey is LXQJFVAXRUDIER-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25F3N2O5/c1-18(2,3)29-17(26)24-8-6-12(19(20,21)22)11-14(25)15-13(5-4-7-23-15)16-27-9-10-28-16/h4-5,7,12,16H,6,8-11H2,1-3H3,(H,24,26).
What are the key properties of tert-butyl N-[5-[3-(1,3-dioxolan-2-yl)-2-pyridinyl]-5-oxo-3-(trifluoromethyl)pentyl]carbamate?
tert-butyl N-[5-[3-(1,3-dioxolan-2-yl)-2-pyridinyl]-5-oxo-3-(trifluoromethyl)pentyl]carbamate has a molecular weight of 418.41 g/mol, XLogP of 3.79, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[5-[3-(1,3-dioxolan-2-yl)-2-pyridinyl]-5-oxo-3-(trifluoromethyl)pentyl]carbamate is sourced from PubChem (CID 170947928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).