C31H40N2O6 — CID 125428278
(1S,2R,9R)-11-[2-[(4-butyl-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-h]chromen-5-yl)oxy]acetyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one (PubChem CID 125428278) has the molecular formula C31H40N2O6 and a molecular weight of 536.67 g/mol. Its IUPAC name is (1S,2R,9R)-11-[2-[(4-butyl-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-h]chromen-5-yl)oxy]acetyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one.
| Compound Name | (1S,2R,9R)-11-[2-[(4-butyl-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-h]chromen-5-yl)oxy]acetyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
|---|---|
| PubChem CID | 125428278 |
| Molecular Formula | C31H40N2O6 |
| Molecular Weight | 536.67 g/mol |
| Exact Mass | 536.29 |
| IUPAC Name | (1S,2R,9R)-11-[2-[(4-butyl-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-h]chromen-5-yl)oxy]acetyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
| SMILES | CCCCc1cc(=O)oc2c3c(cc(OCC(=O)N4C[C@H]5C[C@@H](C4)[C@H]4CCCC(=O)N4C5)c12)OC(C)(C)CC3 |
| InChI | InChI=1S/C31H40N2O6/c1-4-5-7-20-13-28(36)38-30-22-10-11-31(2,3)39-24(22)14-25(29(20)30)37-18-27(35)32-15-19-12-21(17-32)23-8-6-9-26(34)33(23)16-19/h13-14,19,21,23H,4-12,15-18H2,1-3H3/t19-,21+,23-/m1/s1 |
| InChIKey | CWZGFRVZXUNRBH-UNWVZKJWSA-N |
| XLogP | 4.48 |
| TPSA | 89.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.67 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|