C31H35N3O8 — CID 171363334
(9R)-11-[2-[(4-butyl-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-h]chromen-5-yl)oxy]acetyl]-5-nitro-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 171363334) has the molecular formula C31H35N3O8 and a molecular weight of 577.63 g/mol. Its IUPAC name is (9R)-11-[2-[(4-butyl-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-h]chromen-5-yl)oxy]acetyl]-5-nitro-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (9R)-11-[2-[(4-butyl-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-h]chromen-5-yl)oxy]acetyl]-5-nitro-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 171363334 |
| Molecular Formula | C31H35N3O8 |
| Molecular Weight | 577.63 g/mol |
| Exact Mass | 577.24 |
| IUPAC Name | (9R)-11-[2-[(4-butyl-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-h]chromen-5-yl)oxy]acetyl]-5-nitro-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | CCCCc1cc(=O)oc2c3c(cc(OCC(=O)N4CC5C[C@H](C4)Cn4c5ccc([N+](=O)[O-])c4=O)c12)OC(C)(C)CC3 |
| InChI | InChI=1S/C31H35N3O8/c1-4-5-6-19-12-27(36)41-29-21-9-10-31(2,3)42-24(21)13-25(28(19)29)40-17-26(35)32-14-18-11-20(16-32)22-7-8-23(34(38)39)30(37)33(22)15-18/h7-8,12-13,18,20H,4-6,9-11,14-17H2,1-3H3/t18-,20?/m1/s1 |
| InChIKey | JYVSTBJECRWNBJ-QSVWIEALSA-N |
| XLogP | 4.33 |
| TPSA | 134.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.63 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|