C35H35N3O8 — CID 125428731
(1R,9S)-11-[2-[(3-benzyl-4,8,8-trimethyl-2-oxo-9,10-dihydropyrano[2,3-h]chromen-5-yl)oxy]acetyl]-5-nitro-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 125428731) has the molecular formula C35H35N3O8 and a molecular weight of 625.68 g/mol. Its IUPAC name is (1R,9S)-11-[2-[(3-benzyl-4,8,8-trimethyl-2-oxo-9,10-dihydropyrano[2,3-h]chromen-5-yl)oxy]acetyl]-5-nitro-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1R,9S)-11-[2-[(3-benzyl-4,8,8-trimethyl-2-oxo-9,10-dihydropyrano[2,3-h]chromen-5-yl)oxy]acetyl]-5-nitro-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 125428731 |
| Molecular Formula | C35H35N3O8 |
| Molecular Weight | 625.68 g/mol |
| Exact Mass | 625.24 |
| IUPAC Name | (1R,9S)-11-[2-[(3-benzyl-4,8,8-trimethyl-2-oxo-9,10-dihydropyrano[2,3-h]chromen-5-yl)oxy]acetyl]-5-nitro-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | Cc1c(Cc2ccccc2)c(=O)oc2c3c(cc(OCC(=O)N4C[C@@H]5C[C@H](C4)c4ccc([N+](=O)[O-])c(=O)n4C5)c12)OC(C)(C)CC3 |
| InChI | InChI=1S/C35H35N3O8/c1-20-25(14-21-7-5-4-6-8-21)34(41)45-32-24-11-12-35(2,3)46-28(24)15-29(31(20)32)44-19-30(39)36-16-22-13-23(18-36)26-9-10-27(38(42)43)33(40)37(26)17-22/h4-10,15,22-23H,11-14,16-19H2,1-3H3/t22-,23+/m0/s1 |
| InChIKey | WMJURSPHDBFJCP-XZOQPEGZSA-N |
| XLogP | 4.89 |
| TPSA | 134.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.68 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|