C34H31N3O7 — CID 126417466
(1R,9S)-5-nitro-11-[3-(2,5,9-trimethyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)propanoyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 126417466) has the molecular formula C34H31N3O7 and a molecular weight of 593.64 g/mol. Its IUPAC name is (1R,9S)-5-nitro-11-[3-(2,5,9-trimethyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)propanoyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1R,9S)-5-nitro-11-[3-(2,5,9-trimethyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)propanoyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 126417466 |
| Molecular Formula | C34H31N3O7 |
| Molecular Weight | 593.64 g/mol |
| Exact Mass | 593.22 |
| IUPAC Name | (1R,9S)-5-nitro-11-[3-(2,5,9-trimethyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)propanoyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | Cc1oc2c(C)c3oc(=O)c(CCC(=O)N4C[C@@H]5C[C@H](C4)c4ccc([N+](=O)[O-])c(=O)n4C5)c(C)c3cc2c1-c1ccccc1 |
| InChI | InChI=1S/C34H31N3O7/c1-18-24(9-12-29(38)35-15-21-13-23(17-35)27-10-11-28(37(41)42)33(39)36(27)16-21)34(40)44-31-19(2)32-26(14-25(18)31)30(20(3)43-32)22-7-5-4-6-8-22/h4-8,10-11,14,21,23H,9,12-13,15-17H2,1-3H3/t21-,23+/m0/s1 |
| InChIKey | DSCBDFUCIAJBCG-JTHBVZDNSA-N |
| XLogP | 5.78 |
| TPSA | 128.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.64 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|