C33H30N3O7- — CID 163124305
5-[hydroxy(oxido)amino]-11-[2-(2,5,9-trimethyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)acetyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 163124305) has the molecular formula C33H30N3O7- and a molecular weight of 580.62 g/mol. Its IUPAC name is 5-[hydroxy(oxido)amino]-11-[2-(2,5,9-trimethyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)acetyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | 5-[hydroxy(oxido)amino]-11-[2-(2,5,9-trimethyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)acetyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 163124305 |
| Molecular Formula | C33H30N3O7- |
| Molecular Weight | 580.62 g/mol |
| Exact Mass | 580.21 |
| IUPAC Name | 5-[hydroxy(oxido)amino]-11-[2-(2,5,9-trimethyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)acetyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | Cc1oc2c(C)c3oc(=O)c(CC(=O)N4CC5CC(C4)c4ccc(N([O-])O)c(=O)n4C5)c(C)c3cc2c1-c1ccccc1 |
| InChI | InChI=1S/C33H30N3O7/c1-17-23-12-25-29(21-7-5-4-6-8-21)19(3)42-31(25)18(2)30(23)43-33(39)24(17)13-28(37)34-14-20-11-22(16-34)26-9-10-27(36(40)41)32(38)35(26)15-20/h4-10,12,20,22,40H,11,13-16H2,1-3H3/q-1 |
| InChIKey | NWCVKZCGUCOYCI-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 132.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.62 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|