C23H15NO5 — CID 125428773
(10S)-5-hydroxy-3-phenyl-10-pyridin-4-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 125428773) has the molecular formula C23H15NO5 and a molecular weight of 385.38 g/mol. Its IUPAC name is (10S)-5-hydroxy-3-phenyl-10-pyridin-4-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | (10S)-5-hydroxy-3-phenyl-10-pyridin-4-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 125428773 |
| Molecular Formula | C23H15NO5 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | (10S)-5-hydroxy-3-phenyl-10-pyridin-4-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | O=C1C[C@@H](c2ccncc2)c2c(cc(O)c3c(=O)c(-c4ccccc4)coc23)O1 |
| InChI | InChI=1S/C23H15NO5/c25-17-11-18-20(15(10-19(26)29-18)14-6-8-24-9-7-14)23-21(17)22(27)16(12-28-23)13-4-2-1-3-5-13/h1-9,11-12,15,25H,10H2/t15-/m0/s1 |
| InChIKey | XVMWSEZHCZUVDK-HNNXBMFYSA-N |
| XLogP | 4.00 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|