C23H18N2O4 — CID 125431387
(4S)-6,7-dimethyl-4-(2-oxo-1H-benzo[g]quinolin-3-yl)-3,4-dihydropyrano[3,2-c]pyridine-2,5-dione (PubChem CID 125431387) has the molecular formula C23H18N2O4 and a molecular weight of 386.41 g/mol. Its IUPAC name is (4S)-6,7-dimethyl-4-(2-oxo-1H-benzo[g]quinolin-3-yl)-3,4-dihydropyrano[3,2-c]pyridine-2,5-dione.
| Compound Name | (4S)-6,7-dimethyl-4-(2-oxo-1H-benzo[g]quinolin-3-yl)-3,4-dihydropyrano[3,2-c]pyridine-2,5-dione |
|---|---|
| PubChem CID | 125431387 |
| Molecular Formula | C23H18N2O4 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | (4S)-6,7-dimethyl-4-(2-oxo-1H-benzo[g]quinolin-3-yl)-3,4-dihydropyrano[3,2-c]pyridine-2,5-dione |
| SMILES | Cc1cc2c(c(=O)n1C)[C@H](c1cc3cc4ccccc4cc3[nH]c1=O)CC(=O)O2 |
| InChI | InChI=1S/C23H18N2O4/c1-12-7-19-21(23(28)25(12)2)16(11-20(26)29-19)17-9-15-8-13-5-3-4-6-14(13)10-18(15)24-22(17)27/h3-10,16H,11H2,1-2H3,(H,24,27)/t16-/m0/s1 |
| InChIKey | NSLWZKYJQFXICV-INIZCTEOSA-N |
| XLogP | 3.13 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|