C13H20N4O — CID 125436762
2-[(3R)-3-aminopiperidin-1-yl]-5,6-dimethylpyridine-3-carboxamide (PubChem CID 125436762) has the molecular formula C13H20N4O and a molecular weight of 248.33 g/mol. Its IUPAC name is 2-[(3R)-3-aminopiperidin-1-yl]-5,6-dimethylpyridine-3-carboxamide.
| Compound Name | 2-[(3R)-3-aminopiperidin-1-yl]-5,6-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 125436762 |
| Molecular Formula | C13H20N4O |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 2-[(3R)-3-aminopiperidin-1-yl]-5,6-dimethylpyridine-3-carboxamide |
| SMILES | Cc1cc(C(N)=O)c(N2CCC[C@@H](N)C2)nc1C |
| InChI | InChI=1S/C13H20N4O/c1-8-6-11(12(15)18)13(16-9(8)2)17-5-3-4-10(14)7-17/h6,10H,3-5,7,14H2,1-2H3,(H2,15,18)/t10-/m1/s1 |
| InChIKey | YPLAPUUJQFNDAT-SNVBAGLBSA-N |
| XLogP | 0.72 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |