C16H21N3O — CID 135100714
2-[(3aS,7aR)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-5,6-dimethylpyridine-3-carboxamide (PubChem CID 135100714) has the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. Its IUPAC name is 2-[(3aS,7aR)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-5,6-dimethylpyridine-3-carboxamide.
| Compound Name | 2-[(3aS,7aR)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-5,6-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 135100714 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 2-[(3aS,7aR)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-5,6-dimethylpyridine-3-carboxamide |
| SMILES | Cc1cc(C(N)=O)c(N2C[C@H]3CC=CC[C@H]3C2)nc1C |
| InChI | InChI=1S/C16H21N3O/c1-10-7-14(15(17)20)16(18-11(10)2)19-8-12-5-3-4-6-13(12)9-19/h3-4,7,12-13H,5-6,8-9H2,1-2H3,(H2,17,20)/t12-,13+ |
| InChIKey | NHVOZDOKQLKOKI-BETUJISGSA-N |
| XLogP | 2.20 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|