C14H19N5O3S — CID 125440530
N-[(1S)-1-(4-methylsulfonylphenyl)ethyl]-4-(tetrazol-1-yl)butanamide (PubChem CID 125440530) has the molecular formula C14H19N5O3S and a molecular weight of 337.41 g/mol. Its IUPAC name is N-[(1S)-1-(4-methylsulfonylphenyl)ethyl]-4-(tetrazol-1-yl)butanamide.
| Compound Name | N-[(1S)-1-(4-methylsulfonylphenyl)ethyl]-4-(tetrazol-1-yl)butanamide |
|---|---|
| PubChem CID | 125440530 |
| Molecular Formula | C14H19N5O3S |
| Molecular Weight | 337.41 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | N-[(1S)-1-(4-methylsulfonylphenyl)ethyl]-4-(tetrazol-1-yl)butanamide |
| SMILES | C[C@H](NC(=O)CCCn1cnnn1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C14H19N5O3S/c1-11(12-5-7-13(8-6-12)23(2,21)22)16-14(20)4-3-9-19-10-15-17-18-19/h5-8,10-11H,3-4,9H2,1-2H3,(H,16,20)/t11-/m0/s1 |
| InChIKey | USWBPNVSGFZXPS-NSHDSACASA-N |
| XLogP | 0.73 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.41 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |