C13H17N5O3S — CID 95282708
N-methyl-N-[(1R)-1-(4-methylsulfonylphenyl)ethyl]-2-(tetrazol-1-yl)acetamide (PubChem CID 95282708) has the molecular formula C13H17N5O3S and a molecular weight of 323.38 g/mol. Its IUPAC name is N-methyl-N-[(1R)-1-(4-methylsulfonylphenyl)ethyl]-2-(tetrazol-1-yl)acetamide.
| Compound Name | N-methyl-N-[(1R)-1-(4-methylsulfonylphenyl)ethyl]-2-(tetrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 95282708 |
| Molecular Formula | C13H17N5O3S |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | N-methyl-N-[(1R)-1-(4-methylsulfonylphenyl)ethyl]-2-(tetrazol-1-yl)acetamide |
| SMILES | C[C@H](c1ccc(S(C)(=O)=O)cc1)N(C)C(=O)Cn1cnnn1 |
| InChI | InChI=1S/C13H17N5O3S/c1-10(11-4-6-12(7-5-11)22(3,20)21)17(2)13(19)8-18-9-14-15-16-18/h4-7,9-10H,8H2,1-3H3/t10-/m1/s1 |
| InChIKey | SKIMLAAFIDAIEF-SNVBAGLBSA-N |
| XLogP | 0.30 |
| TPSA | 98.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |