C16H23N5O — CID 125440966
N-[(2R)-4-methyl-4-phenylpentan-2-yl]-3-(tetrazol-1-yl)propanamide (PubChem CID 125440966) has the molecular formula C16H23N5O and a molecular weight of 301.39 g/mol. Its IUPAC name is N-[(2R)-4-methyl-4-phenylpentan-2-yl]-3-(tetrazol-1-yl)propanamide.
| Compound Name | N-[(2R)-4-methyl-4-phenylpentan-2-yl]-3-(tetrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 125440966 |
| Molecular Formula | C16H23N5O |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | N-[(2R)-4-methyl-4-phenylpentan-2-yl]-3-(tetrazol-1-yl)propanamide |
| SMILES | C[C@H](CC(C)(C)c1ccccc1)NC(=O)CCn1cnnn1 |
| InChI | InChI=1S/C16H23N5O/c1-13(11-16(2,3)14-7-5-4-6-8-14)18-15(22)9-10-21-12-17-19-20-21/h4-8,12-13H,9-11H2,1-3H3,(H,18,22)/t13-/m1/s1 |
| InChIKey | SFSNWFMTGHVYAQ-CYBMUJFWSA-N |
| XLogP | 1.94 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |