C20H32N2O — CID 50875407
N-(4-methyl-4-phenylpentan-2-yl)-2-(1-methylpiperidin-4-yl)acetamide (PubChem CID 50875407) has the molecular formula C20H32N2O and a molecular weight of 316.49 g/mol. Its IUPAC name is N-(4-methyl-4-phenylpentan-2-yl)-2-(1-methylpiperidin-4-yl)acetamide.
| Compound Name | N-(4-methyl-4-phenylpentan-2-yl)-2-(1-methylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 50875407 |
| Molecular Formula | C20H32N2O |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.25 |
| IUPAC Name | N-(4-methyl-4-phenylpentan-2-yl)-2-(1-methylpiperidin-4-yl)acetamide |
| SMILES | CC(CC(C)(C)c1ccccc1)NC(=O)CC1CCN(C)CC1 |
| InChI | InChI=1S/C20H32N2O/c1-16(15-20(2,3)18-8-6-5-7-9-18)21-19(23)14-17-10-12-22(4)13-11-17/h5-9,16-17H,10-15H2,1-4H3,(H,21,23) |
| InChIKey | PJBMMEVGNHXLNB-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |