C18H24N6O2 — CID 125442242
3-[(2R)-2-imidazol-1-ylpropyl]-1-[2-(6-methoxy-1H-benzimidazol-2-yl)ethyl]-1-methylurea (PubChem CID 125442242) has the molecular formula C18H24N6O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is 3-[(2R)-2-imidazol-1-ylpropyl]-1-[2-(6-methoxy-1H-benzimidazol-2-yl)ethyl]-1-methylurea.
| Compound Name | 3-[(2R)-2-imidazol-1-ylpropyl]-1-[2-(6-methoxy-1H-benzimidazol-2-yl)ethyl]-1-methylurea |
|---|---|
| PubChem CID | 125442242 |
| Molecular Formula | C18H24N6O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 3-[(2R)-2-imidazol-1-ylpropyl]-1-[2-(6-methoxy-1H-benzimidazol-2-yl)ethyl]-1-methylurea |
| SMILES | COc1ccc2nc(CCN(C)C(=O)NC[C@@H](C)n3ccnc3)[nH]c2c1 |
| InChI | InChI=1S/C18H24N6O2/c1-13(24-9-7-19-12-24)11-20-18(25)23(2)8-6-17-21-15-5-4-14(26-3)10-16(15)22-17/h4-5,7,9-10,12-13H,6,8,11H2,1-3H3,(H,20,25)(H,21,22)/t13-/m1/s1 |
| InChIKey | ODRGDYFHICLCKH-CYBMUJFWSA-N |
| XLogP | 2.21 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |