C19H28ClN5O2 — CID 125435743
1-[2-(6-chloro-1H-benzimidazol-2-yl)ethyl]-1-methyl-3-[(2S)-2-morpholin-4-ylbutyl]urea (PubChem CID 125435743) has the molecular formula C19H28ClN5O2 and a molecular weight of 393.92 g/mol. Its IUPAC name is 1-[2-(6-chloro-1H-benzimidazol-2-yl)ethyl]-1-methyl-3-[(2S)-2-morpholin-4-ylbutyl]urea.
| Compound Name | 1-[2-(6-chloro-1H-benzimidazol-2-yl)ethyl]-1-methyl-3-[(2S)-2-morpholin-4-ylbutyl]urea |
|---|---|
| PubChem CID | 125435743 |
| Molecular Formula | C19H28ClN5O2 |
| Molecular Weight | 393.92 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 1-[2-(6-chloro-1H-benzimidazol-2-yl)ethyl]-1-methyl-3-[(2S)-2-morpholin-4-ylbutyl]urea |
| SMILES | CC[C@@H](CNC(=O)N(C)CCc1nc2ccc(Cl)cc2[nH]1)N1CCOCC1 |
| InChI | InChI=1S/C19H28ClN5O2/c1-3-15(25-8-10-27-11-9-25)13-21-19(26)24(2)7-6-18-22-16-5-4-14(20)12-17(16)23-18/h4-5,12,15H,3,6-11,13H2,1-2H3,(H,21,26)(H,22,23)/t15-/m0/s1 |
| InChIKey | HQIRHJHMDDUWNL-HNNXBMFYSA-N |
| XLogP | 2.51 |
| TPSA | 73.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.92 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |