C17H22ClN3O — CID 125441599
6-chloro-N-[(2R)-2-morpholin-4-ylbutyl]quinolin-2-amine (PubChem CID 125441599) has the molecular formula C17H22ClN3O and a molecular weight of 319.84 g/mol. Its IUPAC name is 6-chloro-N-[(2R)-2-morpholin-4-ylbutyl]quinolin-2-amine.
| Compound Name | 6-chloro-N-[(2R)-2-morpholin-4-ylbutyl]quinolin-2-amine |
|---|---|
| PubChem CID | 125441599 |
| Molecular Formula | C17H22ClN3O |
| Molecular Weight | 319.84 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 6-chloro-N-[(2R)-2-morpholin-4-ylbutyl]quinolin-2-amine |
| SMILES | CC[C@H](CNc1ccc2cc(Cl)ccc2n1)N1CCOCC1 |
| InChI | InChI=1S/C17H22ClN3O/c1-2-15(21-7-9-22-10-8-21)12-19-17-6-3-13-11-14(18)4-5-16(13)20-17/h3-6,11,15H,2,7-10,12H2,1H3,(H,19,20)/t15-/m1/s1 |
| InChIKey | QBUUONGNVJKPEK-OAHLLOKOSA-N |
| XLogP | 3.41 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.84 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |