C19H27ClN4O — CID 72932463
N-[2-(6-chloro-1H-benzimidazol-2-yl)ethyl]-N-methyl-4-piperidin-1-ylbutanamide (PubChem CID 72932463) has the molecular formula C19H27ClN4O and a molecular weight of 362.91 g/mol. Its IUPAC name is N-[2-(6-chloro-1H-benzimidazol-2-yl)ethyl]-N-methyl-4-piperidin-1-ylbutanamide.
| Compound Name | N-[2-(6-chloro-1H-benzimidazol-2-yl)ethyl]-N-methyl-4-piperidin-1-ylbutanamide |
|---|---|
| PubChem CID | 72932463 |
| Molecular Formula | C19H27ClN4O |
| Molecular Weight | 362.91 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | N-[2-(6-chloro-1H-benzimidazol-2-yl)ethyl]-N-methyl-4-piperidin-1-ylbutanamide |
| SMILES | CN(CCc1nc2ccc(Cl)cc2[nH]1)C(=O)CCCN1CCCCC1 |
| InChI | InChI=1S/C19H27ClN4O/c1-23(19(25)6-5-12-24-10-3-2-4-11-24)13-9-18-21-16-8-7-15(20)14-17(16)22-18/h7-8,14H,2-6,9-13H2,1H3,(H,21,22) |
| InChIKey | FOWXBTYUUHCLKY-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.91 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |