C14H25N3O — CID 125442761
N-[(2R)-2-(dimethylamino)-3-methylbutyl]-5-ethyl-1H-pyrrole-2-carboxamide (PubChem CID 125442761) has the molecular formula C14H25N3O and a molecular weight of 251.37 g/mol. Its IUPAC name is N-[(2R)-2-(dimethylamino)-3-methylbutyl]-5-ethyl-1H-pyrrole-2-carboxamide.
| Compound Name | N-[(2R)-2-(dimethylamino)-3-methylbutyl]-5-ethyl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 125442761 |
| Molecular Formula | C14H25N3O |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | N-[(2R)-2-(dimethylamino)-3-methylbutyl]-5-ethyl-1H-pyrrole-2-carboxamide |
| SMILES | CCc1ccc(C(=O)NC[C@@H](C(C)C)N(C)C)[nH]1 |
| InChI | InChI=1S/C14H25N3O/c1-6-11-7-8-12(16-11)14(18)15-9-13(10(2)3)17(4)5/h7-8,10,13,16H,6,9H2,1-5H3,(H,15,18)/t13-/m0/s1 |
| InChIKey | XLPMJYONGLDBAE-ZDUSSCGKSA-N |
| XLogP | 1.89 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |