C17H22N4O3 — CID 125443421
ethyl (3S)-3-[2-(1-oxophthalazin-2-yl)ethylamino]pyrrolidine-1-carboxylate (PubChem CID 125443421) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is ethyl (3S)-3-[2-(1-oxophthalazin-2-yl)ethylamino]pyrrolidine-1-carboxylate.
| Compound Name | ethyl (3S)-3-[2-(1-oxophthalazin-2-yl)ethylamino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 125443421 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | ethyl (3S)-3-[2-(1-oxophthalazin-2-yl)ethylamino]pyrrolidine-1-carboxylate |
| SMILES | CCOC(=O)N1CC[C@H](NCCn2ncc3ccccc3c2=O)C1 |
| InChI | InChI=1S/C17H22N4O3/c1-2-24-17(23)20-9-7-14(12-20)18-8-10-21-16(22)15-6-4-3-5-13(15)11-19-21/h3-6,11,14,18H,2,7-10,12H2,1H3/t14-/m0/s1 |
| InChIKey | FCILRZDYQOEPNI-AWEZNQCLSA-N |
| XLogP | 1.22 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |