C21H29FN4O — CID 125444012
(2S)-N-[3-(2-fluorophenyl)propyl]-2-[2-(2-methylimidazol-1-yl)ethyl]piperidine-1-carboxamide (PubChem CID 125444012) has the molecular formula C21H29FN4O and a molecular weight of 372.49 g/mol. Its IUPAC name is (2S)-N-[3-(2-fluorophenyl)propyl]-2-[2-(2-methylimidazol-1-yl)ethyl]piperidine-1-carboxamide.
| Compound Name | (2S)-N-[3-(2-fluorophenyl)propyl]-2-[2-(2-methylimidazol-1-yl)ethyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 125444012 |
| Molecular Formula | C21H29FN4O |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | (2S)-N-[3-(2-fluorophenyl)propyl]-2-[2-(2-methylimidazol-1-yl)ethyl]piperidine-1-carboxamide |
| SMILES | Cc1nccn1CC[C@@H]1CCCCN1C(=O)NCCCc1ccccc1F |
| InChI | InChI=1S/C21H29FN4O/c1-17-23-13-16-25(17)15-11-19-9-4-5-14-26(19)21(27)24-12-6-8-18-7-2-3-10-20(18)22/h2-3,7,10,13,16,19H,4-6,8-9,11-12,14-15H2,1H3,(H,24,27)/t19-/m0/s1 |
| InChIKey | QTZNUIXZHKZSFR-IBGZPJMESA-N |
| XLogP | 3.92 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|