C23H23N3O3 — CID 125444812
N-[(3S)-1-methyl-6-oxopiperidin-3-yl]-3-(2-methyl-4-oxo-1H-quinolin-6-yl)benzamide (PubChem CID 125444812) has the molecular formula C23H23N3O3 and a molecular weight of 389.46 g/mol. Its IUPAC name is N-[(3S)-1-methyl-6-oxopiperidin-3-yl]-3-(2-methyl-4-oxo-1H-quinolin-6-yl)benzamide.
| Compound Name | N-[(3S)-1-methyl-6-oxopiperidin-3-yl]-3-(2-methyl-4-oxo-1H-quinolin-6-yl)benzamide |
|---|---|
| PubChem CID | 125444812 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | N-[(3S)-1-methyl-6-oxopiperidin-3-yl]-3-(2-methyl-4-oxo-1H-quinolin-6-yl)benzamide |
| SMILES | Cc1cc(=O)c2cc(-c3cccc(C(=O)N[C@H]4CCC(=O)N(C)C4)c3)ccc2[nH]1 |
| InChI | InChI=1S/C23H23N3O3/c1-14-10-21(27)19-12-16(6-8-20(19)24-14)15-4-3-5-17(11-15)23(29)25-18-7-9-22(28)26(2)13-18/h3-6,8,10-12,18H,7,9,13H2,1-2H3,(H,24,27)(H,25,29)/t18-/m0/s1 |
| InChIKey | AMPVBIQJEPIWLG-SFHVURJKSA-N |
| XLogP | 2.85 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |