C18H28FN3 — CID 125447400
1-ethyl-N-[[(3R)-1-(4-fluorophenyl)pyrrolidin-3-yl]methyl]piperidin-4-amine (PubChem CID 125447400) has the molecular formula C18H28FN3 and a molecular weight of 305.44 g/mol. Its IUPAC name is 1-ethyl-N-[[(3R)-1-(4-fluorophenyl)pyrrolidin-3-yl]methyl]piperidin-4-amine.
| Compound Name | 1-ethyl-N-[[(3R)-1-(4-fluorophenyl)pyrrolidin-3-yl]methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 125447400 |
| Molecular Formula | C18H28FN3 |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.23 |
| IUPAC Name | 1-ethyl-N-[[(3R)-1-(4-fluorophenyl)pyrrolidin-3-yl]methyl]piperidin-4-amine |
| SMILES | CCN1CCC(NC[C@H]2CCN(c3ccc(F)cc3)C2)CC1 |
| InChI | InChI=1S/C18H28FN3/c1-2-21-10-8-17(9-11-21)20-13-15-7-12-22(14-15)18-5-3-16(19)4-6-18/h3-6,15,17,20H,2,7-14H2,1H3/t15-/m1/s1 |
| InChIKey | UUOPSDMXHATCIM-OAHLLOKOSA-N |
| XLogP | 2.73 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |