C19H28FN3O2 — CID 71921314
ethyl 4-[[1-(4-fluorophenyl)pyrrolidin-3-yl]methylamino]piperidine-1-carboxylate (PubChem CID 71921314) has the molecular formula C19H28FN3O2 and a molecular weight of 349.45 g/mol. Its IUPAC name is ethyl 4-[[1-(4-fluorophenyl)pyrrolidin-3-yl]methylamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[1-(4-fluorophenyl)pyrrolidin-3-yl]methylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71921314 |
| Molecular Formula | C19H28FN3O2 |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | ethyl 4-[[1-(4-fluorophenyl)pyrrolidin-3-yl]methylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NCC2CCN(c3ccc(F)cc3)C2)CC1 |
| InChI | InChI=1S/C19H28FN3O2/c1-2-25-19(24)22-11-8-17(9-12-22)21-13-15-7-10-23(14-15)18-5-3-16(20)4-6-18/h3-6,15,17,21H,2,7-14H2,1H3 |
| InChIKey | SXHQDRNNNIXKPA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |