C20H29N3O4 — CID 125447458
1-cyclopentyl-1-[(2,3-dimethoxyphenyl)methyl]-3-[(3R)-2-oxopiperidin-3-yl]urea (PubChem CID 125447458) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is 1-cyclopentyl-1-[(2,3-dimethoxyphenyl)methyl]-3-[(3R)-2-oxopiperidin-3-yl]urea.
| Compound Name | 1-cyclopentyl-1-[(2,3-dimethoxyphenyl)methyl]-3-[(3R)-2-oxopiperidin-3-yl]urea |
|---|---|
| PubChem CID | 125447458 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | 1-cyclopentyl-1-[(2,3-dimethoxyphenyl)methyl]-3-[(3R)-2-oxopiperidin-3-yl]urea |
| SMILES | COc1cccc(CN(C(=O)N[C@@H]2CCCNC2=O)C2CCCC2)c1OC |
| InChI | InChI=1S/C20H29N3O4/c1-26-17-11-5-7-14(18(17)27-2)13-23(15-8-3-4-9-15)20(25)22-16-10-6-12-21-19(16)24/h5,7,11,15-16H,3-4,6,8-10,12-13H2,1-2H3,(H,21,24)(H,22,25)/t16-/m1/s1 |
| InChIKey | SHSPMDXGUFNVDS-MRXNPFEDSA-N |
| XLogP | 2.44 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |