C19H22N4OS — CID 125448095
4-(1H-benzimidazol-2-yl)-N-[(1R)-1-thiophen-3-ylethyl]piperidine-1-carboxamide (PubChem CID 125448095) has the molecular formula C19H22N4OS and a molecular weight of 354.48 g/mol. Its IUPAC name is 4-(1H-benzimidazol-2-yl)-N-[(1R)-1-thiophen-3-ylethyl]piperidine-1-carboxamide.
| Compound Name | 4-(1H-benzimidazol-2-yl)-N-[(1R)-1-thiophen-3-ylethyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 125448095 |
| Molecular Formula | C19H22N4OS |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 4-(1H-benzimidazol-2-yl)-N-[(1R)-1-thiophen-3-ylethyl]piperidine-1-carboxamide |
| SMILES | C[C@@H](NC(=O)N1CCC(c2nc3ccccc3[nH]2)CC1)c1ccsc1 |
| InChI | InChI=1S/C19H22N4OS/c1-13(15-8-11-25-12-15)20-19(24)23-9-6-14(7-10-23)18-21-16-4-2-3-5-17(16)22-18/h2-5,8,11-14H,6-7,9-10H2,1H3,(H,20,24)(H,21,22)/t13-/m1/s1 |
| InChIKey | XYQZPPCOOAZVIG-CYBMUJFWSA-N |
| XLogP | 4.27 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |