C22H23N3OS — CID 125448338
[3-(2-amino-6-methyl-1,3-benzothiazol-5-yl)phenyl]-[(2R)-2-propan-2-yl-2,5-dihydropyrrol-1-yl]methanone (PubChem CID 125448338) has the molecular formula C22H23N3OS and a molecular weight of 377.51 g/mol. Its IUPAC name is [3-(2-amino-6-methyl-1,3-benzothiazol-5-yl)phenyl]-[(2R)-2-propan-2-yl-2,5-dihydropyrrol-1-yl]methanone.
| Compound Name | [3-(2-amino-6-methyl-1,3-benzothiazol-5-yl)phenyl]-[(2R)-2-propan-2-yl-2,5-dihydropyrrol-1-yl]methanone |
|---|---|
| PubChem CID | 125448338 |
| Molecular Formula | C22H23N3OS |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | [3-(2-amino-6-methyl-1,3-benzothiazol-5-yl)phenyl]-[(2R)-2-propan-2-yl-2,5-dihydropyrrol-1-yl]methanone |
| SMILES | Cc1cc2sc(N)nc2cc1-c1cccc(C(=O)N2CC=C[C@H]2C(C)C)c1 |
| InChI | InChI=1S/C22H23N3OS/c1-13(2)19-8-5-9-25(19)21(26)16-7-4-6-15(11-16)17-12-18-20(10-14(17)3)27-22(23)24-18/h4-8,10-13,19H,9H2,1-3H3,(H2,23,24)/t19-/m0/s1 |
| InChIKey | OTLZUWLMKDYNMD-IBGZPJMESA-N |
| XLogP | 4.89 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|