C23H25N5O — CID 125443739
[(2S)-2-butyl-2,5-dihydropyrrol-1-yl]-[3-[2-methyl-6-(1,2,4-triazol-4-yl)-3-pyridinyl]phenyl]methanone (PubChem CID 125443739) has the molecular formula C23H25N5O and a molecular weight of 387.49 g/mol. Its IUPAC name is [(2S)-2-butyl-2,5-dihydropyrrol-1-yl]-[3-[2-methyl-6-(1,2,4-triazol-4-yl)-3-pyridinyl]phenyl]methanone.
| Compound Name | [(2S)-2-butyl-2,5-dihydropyrrol-1-yl]-[3-[2-methyl-6-(1,2,4-triazol-4-yl)-3-pyridinyl]phenyl]methanone |
|---|---|
| PubChem CID | 125443739 |
| Molecular Formula | C23H25N5O |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | [(2S)-2-butyl-2,5-dihydropyrrol-1-yl]-[3-[2-methyl-6-(1,2,4-triazol-4-yl)-3-pyridinyl]phenyl]methanone |
| SMILES | CCCC[C@H]1C=CCN1C(=O)c1cccc(-c2ccc(-n3cnnc3)nc2C)c1 |
| InChI | InChI=1S/C23H25N5O/c1-3-4-9-20-10-6-13-28(20)23(29)19-8-5-7-18(14-19)21-11-12-22(26-17(21)2)27-15-24-25-16-27/h5-8,10-12,14-16,20H,3-4,9,13H2,1-2H3/t20-/m0/s1 |
| InChIKey | MEGDLYCADFICTA-FQEVSTJZSA-N |
| XLogP | 4.21 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|