C23H24N2O2 — CID 126424334
5-[3-[(2R)-2-butyl-2,5-dihydropyrrole-1-carbonyl]phenyl]-1,3-dihydroindol-2-one (PubChem CID 126424334) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 5-[3-[(2R)-2-butyl-2,5-dihydropyrrole-1-carbonyl]phenyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[3-[(2R)-2-butyl-2,5-dihydropyrrole-1-carbonyl]phenyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 126424334 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 5-[3-[(2R)-2-butyl-2,5-dihydropyrrole-1-carbonyl]phenyl]-1,3-dihydroindol-2-one |
| SMILES | CCCC[C@@H]1C=CCN1C(=O)c1cccc(-c2ccc3c(c2)CC(=O)N3)c1 |
| InChI | InChI=1S/C23H24N2O2/c1-2-3-8-20-9-5-12-25(20)23(27)18-7-4-6-16(13-18)17-10-11-21-19(14-17)15-22(26)24-21/h4-7,9-11,13-14,20H,2-3,8,12,15H2,1H3,(H,24,26)/t20-/m1/s1 |
| InChIKey | MWZYBNSNVNJDSD-HXUWFJFHSA-N |
| XLogP | 4.42 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|