C18H25N3O4S — CID 99926742
2-[[3-[(2S)-2-butyl-2,5-dihydropyrrole-1-carbonyl]phenyl]sulfonylamino]-N-methylacetamide (PubChem CID 99926742) has the molecular formula C18H25N3O4S and a molecular weight of 379.48 g/mol. Its IUPAC name is 2-[[3-[(2S)-2-butyl-2,5-dihydropyrrole-1-carbonyl]phenyl]sulfonylamino]-N-methylacetamide.
| Compound Name | 2-[[3-[(2S)-2-butyl-2,5-dihydropyrrole-1-carbonyl]phenyl]sulfonylamino]-N-methylacetamide |
|---|---|
| PubChem CID | 99926742 |
| Molecular Formula | C18H25N3O4S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 2-[[3-[(2S)-2-butyl-2,5-dihydropyrrole-1-carbonyl]phenyl]sulfonylamino]-N-methylacetamide |
| SMILES | CCCC[C@H]1C=CCN1C(=O)c1cccc(S(=O)(=O)NCC(=O)NC)c1 |
| InChI | InChI=1S/C18H25N3O4S/c1-3-4-8-15-9-6-11-21(15)18(23)14-7-5-10-16(12-14)26(24,25)20-13-17(22)19-2/h5-7,9-10,12,15,20H,3-4,8,11,13H2,1-2H3,(H,19,22)/t15-/m0/s1 |
| InChIKey | IUPLJIQDBYGCRT-HNNXBMFYSA-N |
| XLogP | 1.28 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|