C22H25N3O2 — CID 126430092
2-[4-[(2R)-2-butyl-2,5-dihydropyrrole-1-carbonyl]phenyl]-N-methylpyridine-4-carboxamide (PubChem CID 126430092) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is 2-[4-[(2R)-2-butyl-2,5-dihydropyrrole-1-carbonyl]phenyl]-N-methylpyridine-4-carboxamide.
| Compound Name | 2-[4-[(2R)-2-butyl-2,5-dihydropyrrole-1-carbonyl]phenyl]-N-methylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 126430092 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 2-[4-[(2R)-2-butyl-2,5-dihydropyrrole-1-carbonyl]phenyl]-N-methylpyridine-4-carboxamide |
| SMILES | CCCC[C@@H]1C=CCN1C(=O)c1ccc(-c2cc(C(=O)NC)ccn2)cc1 |
| InChI | InChI=1S/C22H25N3O2/c1-3-4-6-19-7-5-14-25(19)22(27)17-10-8-16(9-11-17)20-15-18(12-13-24-20)21(26)23-2/h5,7-13,15,19H,3-4,6,14H2,1-2H3,(H,23,26)/t19-/m1/s1 |
| InChIKey | FBOOHEUEAUQIJG-LJQANCHMSA-N |
| XLogP | 3.68 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|