C19H26N4O2 — CID 74238564
[3-(2-butyl-2,5-dihydropyrrole-1-carbonyl)pyrazin-2-yl]-piperidin-1-ylmethanone (PubChem CID 74238564) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is [3-(2-butyl-2,5-dihydropyrrole-1-carbonyl)pyrazin-2-yl]-piperidin-1-ylmethanone.
| Compound Name | [3-(2-butyl-2,5-dihydropyrrole-1-carbonyl)pyrazin-2-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 74238564 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | [3-(2-butyl-2,5-dihydropyrrole-1-carbonyl)pyrazin-2-yl]-piperidin-1-ylmethanone |
| SMILES | CCCCC1C=CCN1C(=O)c1nccnc1C(=O)N1CCCCC1 |
| InChI | InChI=1S/C19H26N4O2/c1-2-3-8-15-9-7-14-23(15)19(25)17-16(20-10-11-21-17)18(24)22-12-5-4-6-13-22/h7,9-11,15H,2-6,8,12-14H2,1H3 |
| InChIKey | JFOONCAPLMJUSL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|