About amino-[(1-benzoyl-2,5-dihydropyrrol-2-yl)methyl]carbamic acid
amino-[(1-benzoyl-2,5-dihydropyrrol-2-yl)methyl]carbamic acid (PubChem CID 174487355) has the molecular formula C13H15N3O3
and a molecular weight of 261.28 g/mol. Its IUPAC name is amino-[(1-benzoyl-2,5-dihydropyrrol-2-yl)methyl]carbamic acid.
Molecular Properties
| Compound Name | amino-[(1-benzoyl-2,5-dihydropyrrol-2-yl)methyl]carbamic acid |
| PubChem CID | 174487355 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | amino-[(1-benzoyl-2,5-dihydropyrrol-2-yl)methyl]carbamic acid |
| SMILES | NN(CC1C=CCN1C(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C13H15N3O3/c14-16(13(18)19)9-11-7-4-8-15(11)12(17)10-5-2-1-3-6-10/h1-7,11H,8-9,14H2,(H,18,19) |
| InChIKey | GAFLLGCHYFSKHD-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze amino-[(1-benzoyl-2,5-dihydropyrrol-2-yl)methyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino-[(1-benzoyl-2,5-dihydropyrrol-2-yl)methyl]carbamic acid?
The IUPAC name of amino-[(1-benzoyl-2,5-dihydropyrrol-2-yl)methyl]carbamic acid (CID 174487355) is amino-[(1-benzoyl-2,5-dihydropyrrol-2-yl)methyl]carbamic acid.
What is the SMILES notation for amino-[(1-benzoyl-2,5-dihydropyrrol-2-yl)methyl]carbamic acid?
The canonical SMILES for amino-[(1-benzoyl-2,5-dihydropyrrol-2-yl)methyl]carbamic acid is NN(CC1C=CCN1C(=O)c1ccccc1)C(=O)O.
What is the InChIKey of amino-[(1-benzoyl-2,5-dihydropyrrol-2-yl)methyl]carbamic acid?
The InChIKey is GAFLLGCHYFSKHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O3/c14-16(13(18)19)9-11-7-4-8-15(11)12(17)10-5-2-1-3-6-10/h1-7,11H,8-9,14H2,(H,18,19).
What are the key properties of amino-[(1-benzoyl-2,5-dihydropyrrol-2-yl)methyl]carbamic acid?
amino-[(1-benzoyl-2,5-dihydropyrrol-2-yl)methyl]carbamic acid has a molecular weight of 261.28 g/mol, XLogP of 0.92, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for amino-[(1-benzoyl-2,5-dihydropyrrol-2-yl)methyl]carbamic acid is sourced from PubChem (CID 174487355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).