C18H16N4O2 — CID 610745
1-(4-phenyldiazenylbenzoyl)-2,5-dihydropyrrole-2-carboxamide (PubChem CID 610745) has the molecular formula C18H16N4O2 and a molecular weight of 320.35 g/mol. Its IUPAC name is 1-(4-phenyldiazenylbenzoyl)-2,5-dihydropyrrole-2-carboxamide.
| Compound Name | 1-(4-phenyldiazenylbenzoyl)-2,5-dihydropyrrole-2-carboxamide |
|---|---|
| PubChem CID | 610745 |
| Molecular Formula | C18H16N4O2 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 1-(4-phenyldiazenylbenzoyl)-2,5-dihydropyrrole-2-carboxamide |
| SMILES | NC(=O)C1C=CCN1C(=O)c1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C18H16N4O2/c19-17(23)16-7-4-12-22(16)18(24)13-8-10-15(11-9-13)21-20-14-5-2-1-3-6-14/h1-11,16H,12H2,(H2,19,23)/b21-20+ |
| InChIKey | UKVZOHPIPKSIDD-QZQOTICOSA-N |
| XLogP | 2.97 |
| TPSA | 88.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|